CAS 127169-00-0
:(2-BENZYLISOINDOLIN-4-YL)METHANAMINE
Description:
(2-Benzylisoindolin-4-yl)methanamine, identified by its CAS number 127169-00-0, is a chemical compound that features a complex structure characterized by an isoindoline core substituted with a benzyl group and a methanamine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and interactions. The presence of the isoindoline moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The benzyl group may enhance lipophilicity, potentially affecting the compound's bioavailability and pharmacokinetics. Additionally, the methanamine group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, the unique structural features of (2-benzylisoindolin-4-yl)methanamine contribute to its potential utility in various chemical and biological applications, although specific characteristics such as solubility, melting point, and stability would require empirical investigation.
Formula:C16H18N2
InChI:InChI=1/C16H18N2/c17-9-14-7-4-8-15-11-18(12-16(14)15)10-13-5-2-1-3-6-13/h1-8H,9-12,17H2
SMILES:c1ccc(cc1)CN1Cc2cccc(CN)c2C1
Synonyms:- 1-(2-Benzyl-2,3-dihydro-1H-isoindol-4-yl)methanamine
- 1H-Isoindole-4-methanamine, 2,3-dihydro-2-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
