CAS 127170-74-5
:2-hydroxy-3-(3H-imidazol-4-ylmethyl)-N-methyl-benzamide hydrochloride
Description:
2-Hydroxy-3-(3H-imidazol-4-ylmethyl)-N-methyl-benzamide hydrochloride is a chemical compound characterized by its complex structure, which includes a benzamide core substituted with a hydroxyl group and an imidazole moiety. This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, making it suitable for pharmaceutical applications. Its molecular structure suggests potential biological activity, particularly in medicinal chemistry, where it may serve as a lead compound for drug development. The presence of the imidazole ring is significant, as it is often associated with biological activity, including antimicrobial and antifungal properties. The hydrochloride salt form enhances its stability and solubility, which is advantageous for formulation in drug delivery systems. As with many compounds, safety and handling precautions should be observed, as it may exhibit specific toxicity or reactivity profiles. Overall, 2-hydroxy-3-(3H-imidazol-4-ylmethyl)-N-methyl-benzamide hydrochloride represents a noteworthy compound in the realm of chemical research and pharmaceutical development.
Formula:C12H14ClN3O2
InChI:InChI=1/C12H13N3O2.ClH/c1-13-12(17)10-4-2-3-8(11(10)16)5-9-6-14-7-15-9;/h2-4,6-7,16H,5H2,1H3,(H,13,17)(H,14,15);1H
SMILES:CN=C(c1cccc(Cc2cnc[nH]2)c1O)O.Cl
Synonyms:- Benzamide, 2-hydroxy-3-(1H-imidazol-4-ylmethyl)-N-methyl-, monohydrochloride
- 2-Hydroxy-3-((1H-imidazol-4-yl)methyl)-N-methylbenzamide hydrochloride
- 2-Hydroxy-3-(1H-imidazol-4-ylmethyl)-N-methylbenzamide monohydrochloride
- 2-hydroxy-3-(1H-imidazol-5-ylmethyl)-N-methylbenzamide hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.