CymitQuimica logo

CAS 127170-87-0

:

2-hydroxy-3-(1H-imidazol-5-ylmethyl)-6-methylbenzamide hydrochloride

Description:
2-Hydroxy-3-(1H-imidazol-5-ylmethyl)-6-methylbenzamide hydrochloride is a chemical compound characterized by its complex structure, which includes a benzamide core substituted with a hydroxyl group and an imidazole moiety. This compound typically exhibits properties such as solubility in water due to the presence of the hydrochloride salt form, which enhances its stability and bioavailability. The imidazole ring contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. The presence of the hydroxyl and methyl groups can influence its reactivity and interaction with biological systems. Additionally, the compound may exhibit various functional properties, including potential antimicrobial or antifungal activities, depending on its specific interactions at the molecular level. Overall, 2-hydroxy-3-(1H-imidazol-5-ylmethyl)-6-methylbenzamide hydrochloride represents a unique chemical entity with potential applications in medicinal chemistry and drug development.
Formula:C12H14ClN3O2
InChI:InChI=1/C12H13N3O2.ClH/c1-7-2-3-8(4-9-5-14-6-15-9)11(16)10(7)12(13)17;/h2-3,5-6,16H,4H2,1H3,(H2,13,17)(H,14,15);1H
SMILES:Cc1ccc(Cc2cnc[nH]2)c(c1C(=N)O)O.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.