CymitQuimica logo

CAS 127171-58-8

:

N-(4-hydroxy-4-pyridin-3-yl-pentyl)-N-methyl-nitrous amide

Description:
N-(4-hydroxy-4-pyridin-3-yl-pentyl)-N-methyl-nitrous amide, with the CAS number 127171-58-8, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a nitrous amide functional group. The presence of the hydroxyl group on the pyridine ring contributes to its potential for hydrogen bonding, influencing its solubility and reactivity. The pentyl chain provides hydrophobic characteristics, which can affect the compound's interaction with biological membranes. This compound may exhibit biological activity due to its structural components, making it of interest in medicinal chemistry and pharmacology. Its nitrous amide group suggests potential reactivity, particularly in the context of forming nitroso compounds under certain conditions. Overall, the combination of these functional groups may impart specific properties, such as lipophilicity and the ability to participate in various chemical reactions, which could be relevant for applications in drug development or as a research chemical. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C11H17N3O2
InChI:InChI=1/C11H17N3O2/c1-11(15,6-4-8-14(2)13-16)10-5-3-7-12-9-10/h3,5,7,9,15H,4,6,8H2,1-2H3
SMILES:CC(CCCN(C)N=O)(c1cccnc1)O
Synonyms:
  • 3-Pyridinemethanol, alpha-methyl-alpha-(3-(methylnitrosoamino)propyl)-
  • 5-[Methyl(Nitroso)Amino]-2-(Pyridin-3-Yl)Pentan-2-Ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.