CAS 127191-86-0: 7-(deoxyadenosin-N(6)-yl)aristolactam I
Description:7-(Deoxyadenosin-N(6)-yl)aristolactam I, identified by its CAS number 127191-86-0, is a chemical compound that exhibits unique structural and functional characteristics. It is a derivative of deoxyadenosine, which is a nucleoside lacking an oxygen atom at the 2' position of the ribose sugar, and is modified by the presence of an aristolactam moiety. This compound is notable for its potential biological activity, particularly in the context of nucleic acid interactions and cellular processes. Its structure suggests that it may participate in hydrogen bonding and stacking interactions, which are crucial for binding to nucleic acids. Additionally, the presence of the aristolactam group may impart specific pharmacological properties, making it of interest in medicinal chemistry and drug development. The compound's solubility, stability, and reactivity would depend on its specific functional groups and overall molecular conformation, influencing its potential applications in biochemical research and therapeutic contexts. Further studies would be necessary to elucidate its precise mechanisms of action and potential uses.
Formula:C27H22N6O7
InChI:InChI=1/C27H22N6O7/c1-37-14-4-2-3-11-18(14)21(22-19-12(27(36)32-22)5-15-24(20(11)19)39-10-38-15)31-25-23-26(29-8-28-25)33(9-30-23)17-6-13(35)16(7-34)40-17/h2-5,8-9,13,16-17,34-35H,6-7,10H2,1H3,(H,32,36)(H,28,29,31)
- Synonyms:
- dA-Aai
- Adenosine, 2'-deoxy-N-(5,6-dihydro-8-methoxy-5-oxobenzo(f)-1,3-benzodioxolo(6,5,4-cd)indol-7-yl)-
- N-[9-(2-deoxypentofuranosyl)-9H-purin-6-yl]-8-methoxy-5-oxo-5,6-dihydro[1,3]benzodioxolo[6,5,4-cd]benzo[f]indol-7-amine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 7-(deoxyadenosin-N(6)-yl)aristolactam I REF: TM-TJS1226CAS: 127191-86-0 | 98% | 215.00 € | Mon 21 Apr 25 |
![]() | Aristolactam I REF: BP-BP1511CAS: 127191-86-0 | 95%~99% | To inquire | Tue 22 Apr 25 |
![]() | 7-(Deoxyadenosin-N(6)-yl)aristolactam I REF: 3D-FD166124CAS: 127191-86-0 | Min. 95% | - - - | Discontinued product |

7-(deoxyadenosin-N(6)-yl)aristolactam I
Ref: TM-TJS1226
5mg | 215.00 € |

Aristolactam I
Ref: BP-BP1511
Undefined size | To inquire |

7-(Deoxyadenosin-N(6)-yl)aristolactam I
Ref: 3D-FD166124
1mg | Discontinued | Request information | |
2mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information |