
CAS 127191-99-5
:(2Z)-3-Hydroxy-1,3-di-2-thienyl-2-propen-1-one
Description:
(2Z)-3-Hydroxy-1,3-di-2-thienyl-2-propen-1-one, with the CAS number 127191-99-5, is an organic compound characterized by its unique structure featuring two thienyl groups attached to a propenone backbone. This compound exhibits a conjugated system, which contributes to its potential for various chemical reactivity and biological activity. The presence of the hydroxyl group enhances its polarity and solubility in polar solvents, while the thienyl rings can participate in π-π stacking interactions, influencing its physical properties. It may exhibit interesting optical properties due to its conjugated double bonds, making it a candidate for applications in organic electronics or as a dye. Additionally, the compound's structure suggests potential antioxidant or antimicrobial activities, which are common in thienyl-containing compounds. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest in both synthetic and medicinal chemistry. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C11H8O2S2
InChI:InChI=1S/C11H8O2S2/c12-8(10-3-1-5-14-10)7-9(13)11-4-2-6-15-11/h1-7,12H/b8-7-
InChI key:InChIKey=LSZVMHRIKBGPFO-FPLPWBNLSA-N
SMILES:C(/C=C(\O)/C1=CC=CS1)(=O)C2=CC=CS2
Synonyms:- 2-Propen-1-one, 3-hydroxy-1,3-di-2-thienyl-, (Z)-
- (2Z)-3-Hydroxy-1,3-di-2-thienyl-2-propen-1-one
- 2-Propen-1-one, 3-hydroxy-1,3-di-2-thienyl-, (2Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.