CymitQuimica logo

CAS 127199-26-2

:

3-Quinolinecarboxylic acid,8-chloro-6,7-difluoro-1-[(1S,2R)-2-fluorocyclopropyl]-1,4-dihydro-4-oxo-

Description:
3-Quinolinecarboxylic acid, 8-chloro-6,7-difluoro-1-[(1S,2R)-2-fluorocyclopropyl]-1,4-dihydro-4-oxo- is a complex organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. The presence of multiple halogen substituents, specifically chlorine and fluorine, contributes to its unique chemical reactivity and potential biological activity. The cyclopropyl group, particularly in the (1S,2R) configuration, adds to the compound's stereochemistry, influencing its interactions in biological systems. This compound may exhibit properties such as antimicrobial or antiviral activity, making it of interest in pharmaceutical research. Its carboxylic acid functional group suggests potential for forming salts or esters, which can enhance solubility and bioavailability. The specific arrangement of substituents and the presence of the quinoline moiety may also affect its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Overall, this compound represents a significant area of study in medicinal chemistry and drug development.
Formula:C13H7ClF3NO3
InChI:InChI=1S/C13H7ClF3NO3/c14-9-10(17)7(16)1-4-11(9)18(8-2-6(8)15)3-5(12(4)19)13(20)21/h1,3,6,8H,2H2,(H,20,21)/t6-,8+/m1/s1
InChI key:HYNVUCYYHOBXLB-SVRRBLITSA-N
SMILES:C1[C@@H]([C@@H]1F)N2C=C(C(=O)C3=CC(=C(C(=C32)Cl)F)F)C(=O)O
Found 3 products.