
CAS 127199-59-1
:4,5-Dihydro-2-(3-methyl-2-thienyl)-1H-imidazole
Description:
4,5-Dihydro-2-(3-methyl-2-thienyl)-1H-imidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a thienyl group, specifically a 3-methyl-2-thienyl substituent, which contributes to its unique chemical properties and potential biological activity. The presence of the thienyl group can enhance lipophilicity and influence the compound's interaction with biological targets. The dihydro form indicates that the compound has two hydrogen atoms added to the imidazole ring, which may affect its reactivity and stability. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the molecular structure suggests potential for various chemical reactions, including substitution and cyclization, which can be explored for synthetic applications. Overall, 4,5-Dihydro-2-(3-methyl-2-thienyl)-1H-imidazole represents a class of compounds that may have significant implications in drug development and materials science.
Formula:C8H10N2S
InChI:InChI=1S/C8H10N2S/c1-6-2-5-11-7(6)8-9-3-4-10-8/h2,5H,3-4H2,1H3,(H,9,10)
InChI key:InChIKey=MCGKHSFUMBTMDI-UHFFFAOYSA-N
SMILES:CC1=C(SC=C1)C=2NCCN2
Synonyms:- 1H-Imidazole, 4,5-dihydro-2-(3-methyl-2-thienyl)-
- 4,5-Dihydro-2-(3-methyl-2-thienyl)-1H-imidazole
- 2-(3-Methylthiophen-2-yl)-4,5-dihydro-1H-imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.