CAS 127211-03-4

[1,1′-Biphenanthrene]-2,2′,7,7′-tetrol, 9,10-dihydro-4,4′-dimethoxy-, (-)-

Description:

[1,1′-Biphenanthrene]-2,2′,7,7′-tetrol, 9,10-dihydro-4,4′-dimethoxy-, (-)-, with CAS number 127211-03-4, is a complex organic compound characterized by its polycyclic aromatic structure, which consists of multiple fused aromatic rings. This compound features hydroxyl (-OH) groups at specific positions, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of methoxy (-OCH3) groups enhances its solubility and reactivity, making it suitable for various chemical reactions. As a stereoisomer, the (-)- designation indicates its specific chiral configuration, which can influence its biological activity and interactions. The compound's unique structure may also impart interesting optical properties, making it a candidate for applications in materials science and photonics. Overall, its intricate arrangement of functional groups and aromatic systems suggests potential utility in research areas such as drug development, organic electronics, and environmental chemistry.

Formula: C₃₀H₂₄O₆

InChI: InChI=1/C30H24O6/c1-35-25-13-23(33)29(21-7-3-15-11-17(31)5-9-19(15)27(21)25)30-22-8-4-16-12-18(32)6-10-20(16)28(22)26(36-2)14-24(30)34/h3,5-7,9-14,31-34H,4,8H2,1-2H3

InChI key: InChIKey=LCCDZCVHGDFKNQ-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=C(C(O)=C1)C=3C=4C(=C5C(=CC4)C=C(O)C=C5)C(OC)=CC3O)CCC=6C2=CC=C(O)C6

Synonyms:

• Blestriarene B
• [1,1′-Biphenanthrene]-2,2′,7,7′-tetrol, 9,10-dihydro-4,4′-dimethoxy-, (-)-
• (-)-Blestriarene B
• [1,1'-biphenanthrene]-2,2',7,7'-tetrol, 9,10-dihydro-4,4'-dimethoxy-
• [1,1'-Biphenanthrene]-2,2',7,7'-tetrol,9,10-dihydro-4,4'-dimethoxy-, (-)- (9CI)

Blestriarene B

CAS: 127211-03-4

(-)-Blestriarene B, a stilbenoid derived from the tubers of Bletilla striata (Orchidaceae), was isolated based on its ability to inhibit tubulin polymerization

Formula: C₃₀H₂₄O₆

Color and Shape: Solid

Molecular weight: 480.51

Ref: TM-T82857

Blestriarene B

CAS: 127211-03-4

Formula: C₃₀H₂₄O₆

Purity: 95%~99%

Molecular weight: 480.516

Ref: BP-BP4566