CymitQuimica logo

CAS 127223-93-2

:

(E)-4-(Dimethylamino)-1,1,1-trifluorobut-3-en-2-one

Description:
(E)-4-(Dimethylamino)-1,1,1-trifluorobut-3-en-2-one, with CAS number 127223-93-2, is an organic compound characterized by its unique structural features, including a trifluoromethyl group and a dimethylamino substituent. This compound belongs to the class of enones, which are known for their conjugated double bonds that contribute to their reactivity and potential applications in organic synthesis. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The dimethylamino group can act as a nucleophile, participating in various chemical reactions. Additionally, the compound's geometric configuration as an (E)-isomer indicates the specific arrangement of substituents around the double bond, which can affect its physical properties and reactivity. Overall, this compound's distinctive functional groups and structural characteristics make it a valuable subject of study in both synthetic and applied chemistry contexts.
Formula:C6H8F3NO
InChI:InChI=1S/C6H8F3NO/c1-10(2)4-3-5(11)6(7,8)9/h3-4H,1-2H3/b4-3+
InChI key:OPFMBYIQGSJDOB-ONEGZZNKSA-N
SMILES:CN(C)/C=C/C(=O)C(F)(F)F
Found 4 products.