CAS 127223-95-4
:1,1,1-Trifluoro-4-isopropylamino-pent-3-en-2-one
Description:
1,1,1-Trifluoro-4-isopropylamino-pent-3-en-2-one, with the CAS number 127223-95-4, is a synthetic organic compound characterized by its unique trifluoromethyl group and an isopropylamino moiety. This compound features a pentenone structure, indicating the presence of both a double bond and a ketone functional group. The trifluoromethyl group contributes to its chemical stability and influences its reactivity, making it a valuable intermediate in various chemical syntheses. The isopropylamino group enhances its potential biological activity, which may be of interest in pharmaceutical applications. The compound is likely to exhibit polar characteristics due to the presence of electronegative fluorine atoms and the amino group, affecting its solubility and interaction with biological systems. Additionally, the presence of the double bond suggests potential for further chemical transformations, such as addition reactions. Overall, this compound's unique structure and functional groups make it a subject of interest in both organic chemistry and medicinal chemistry research.
Formula:C8H12F3NO
InChI:InChI=1/C8H12F3NO/c1-5(2)12-6(3)4-7(13)8(9,10)11/h4-5,12H,1-3H3/b6-4-
SMILES:CC(C)N/C(=C\C(=O)C(F)(F)F)/C
Synonyms:- 1,1,1-Trifluoro-4-[(1-Methylethyl)Amino]Pent-3-En-2-One
- (3Z)-1,1,1-trifluoro-4-[(1-methylethyl)amino]pent-3-en-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

