CymitQuimica logo

CAS 1272412-65-3

:

2-[2,2-Difluoro-1-[(2-methoxyethoxy)methoxy]ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-[2,2-Difluoro-1-[(2-methoxyethoxy)methoxy]ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a complex organic compound characterized by its unique boron-containing dioxaborolane structure, which contributes to its potential applications in organic synthesis and materials science. The presence of difluoro and methoxyethoxy substituents enhances its reactivity and solubility in various organic solvents. This compound is likely to exhibit interesting electronic properties due to the presence of fluorine atoms, which can influence its stability and interaction with other molecules. Additionally, the dioxaborolane moiety is known for its ability to participate in various chemical reactions, including cross-coupling reactions, making it valuable in the development of pharmaceuticals and agrochemicals. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure, which can be further explored through experimental characterization. Overall, this compound represents a significant area of interest in synthetic chemistry and material development.
Formula:C12H21BF2O5
InChI:InChI=1S/C12H21BF2O5/c1-11(2)12(3,4)20-13(19-11)9(10(14)15)18-8-17-7-6-16-5/h6-8H2,1-5H3
InChI key:InChIKey=IDWBUWZLOWIIFY-UHFFFAOYSA-N
SMILES:C(OCOCCOC)(=C(F)F)B1OC(C)(C)C(C)(C)O1
Synonyms:
  • 1,3,2-Dioxaborolane, 2-[2,2-difluoro-1-[(2-methoxyethoxy)methoxy]ethenyl]-4,4,5,5-tetramethyl-
  • 2-[2,2-Difluoro-1-[(2-methoxyethoxy)methoxy]ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.