CAS 1272412-67-5

B-[2-Chloro-5-[(hydroxyimino)methyl]phenyl]boronic acid

Description:

B-[2-Chloro-5-[(hydroxyimino)methyl]phenyl]boronic acid is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group that features a chlorine substituent and a hydroxyimino functional group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The hydroxyimino group may enhance its reactivity and solubility in polar solvents. Additionally, the chlorine atom can influence the compound's electronic properties and reactivity, potentially making it a candidate for further functionalization or as a building block in drug development. The presence of both the boronic acid and hydroxyimino functionalities suggests potential applications in the development of inhibitors or ligands in biochemical research. Overall, this compound's unique structure and functional groups contribute to its versatility in chemical reactions and applications in various fields.

Formula: C₇H₇BClNO₃

InChI: InChI=1S/C7H7BClNO3/c9-7-2-1-5(4-10-13)3-6(7)8(11)12/h1-4,11-13H

InChI key: InChIKey=NRFCKPJWQMVWJW-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CC(C=NO)=CC=C1Cl

Synonyms:

• B-[2-Chloro-5-[(hydroxyimino)methyl]phenyl]boronic acid
• Boronic acid, B-[2-chloro-5-[(hydroxyimino)methyl]phenyl]-

2-Chloro-5-(hydroxyiminomethyl)phenylboronic acid

CAS: 1272412-67-5

Formula: C₇H₇BClNO₃

Purity: 95%

Molecular weight: 199.3994

Ref: IN-DA009CWG