
CAS 1272412-71-1
:6-Thia-1-azaspiro[3.3]heptane, 6,6-dioxide
Description:
6-Thia-1-azaspiro[3.3]heptane, 6,6-dioxide is a chemical compound characterized by its unique spirocyclic structure, which includes a sulfur atom and a nitrogen atom within its framework. The presence of the sulfur atom contributes to its thia designation, while the nitrogen atom is part of the azaspiro configuration. The "6,6-dioxide" indicates that there are two oxo groups (double-bonded oxygen) attached to the carbon atoms at the 6-position of the spiro system, which can influence the compound's reactivity and stability. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its potential applications could span various fields, including pharmaceuticals and agrochemicals. However, specific data regarding its physical properties, such as solubility, melting point, and spectral characteristics, would require further investigation or experimental determination. Overall, 6-Thia-1-azaspiro[3.3]heptane, 6,6-dioxide represents a complex and potentially valuable compound in chemical research.
Formula:C5H9NO2S
InChI:InChI=1S/C5H9NO2S/c7-9(8)3-5(4-9)1-2-6-5/h6H,1-4H2
InChI key:InChIKey=MOHSPTRYPOIDCV-UHFFFAOYSA-N
SMILES:O=S1(=O)CC2(C1)CCN2
Synonyms:- 6-Thia-1-azaspiro[3.3]heptane, 6,6-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.