CAS 1272412-71-1

6-Thia-1-azaspiro[3.3]heptane, 6,6-dioxide

Description:

6-Thia-1-azaspiro[3.3]heptane, 6,6-dioxide is a chemical compound characterized by its unique spirocyclic structure, which includes a sulfur atom and a nitrogen atom within its framework. The presence of the sulfur atom contributes to its thia designation, while the nitrogen atom is part of the azaspiro configuration. The "6,6-dioxide" indicates that there are two oxo groups (double-bonded oxygen) attached to the carbon atoms at the 6-position of the spiro system, which can influence the compound's reactivity and stability. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its potential applications could span various fields, including pharmaceuticals and agrochemicals. However, specific data regarding its physical properties, such as solubility, melting point, and spectral characteristics, would require further investigation or experimental determination. Overall, 6-Thia-1-azaspiro[3.3]heptane, 6,6-dioxide represents a complex and potentially valuable compound in chemical research.

Formula: C₅H₉NO₂S

InChI: InChI=1S/C5H9NO2S/c7-9(8)3-5(4-9)1-2-6-5/h6H,1-4H2

InChI key: InChIKey=MOHSPTRYPOIDCV-UHFFFAOYSA-N

SMILES: O=S1(=O)CC2(C1)CCN2

Synonyms:

• 6-Thia-1-azaspiro[3.3]heptane, 6,6-dioxide