
CAS 127253-15-0
:(2R,3R)-2,3-Dimethyl-1,4-butanediol
Description:
(2R,3R)-2,3-Dimethyl-1,4-butanediol is a chiral organic compound characterized by its two methyl groups attached to the second and third carbon atoms of a butanediol backbone. This compound features two hydroxyl (-OH) functional groups located at the terminal positions of the butane chain, which contributes to its classification as a diol. The specific stereochemistry indicated by the (2R,3R) notation suggests that both chiral centers are in the R configuration, which can influence the compound's physical and chemical properties, including its solubility and reactivity. Typically, compounds like this may exhibit moderate polarity due to the presence of hydroxyl groups, making them soluble in polar solvents such as water. Additionally, the presence of multiple functional groups can lead to hydrogen bonding, affecting boiling and melting points. This compound may find applications in various fields, including pharmaceuticals, as a building block in organic synthesis, or as a potential intermediate in the production of more complex molecules.
Formula:C6H14O2
InChI:InChI=1S/C6H14O2/c1-5(3-7)6(2)4-8/h5-8H,3-4H2,1-2H3/t5-,6-/m0/s1
InChI key:InChIKey=SKQUTIPQJKQFRA-WDSKDSINSA-N
SMILES:[C@@H]([C@H](CO)C)(CO)C
Synonyms:- 1,4-Butanediol, 2,3-dimethyl-, (2R,3R)-
- (R,R)-2,3-Dimethyl-1,4-butanediol
- (2R,3R)-2,3-Dimethylbutane-1,4-diol
- (2R,3R)-2,3-Dimethyl-1,4-butanediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
