CAS 127266-01-7
:methyl 4-hydroxy-6-methyl-naphthalene-2-carboxylate
Description:
Methyl 4-hydroxy-6-methyl-naphthalene-2-carboxylate, identified by its CAS number 127266-01-7, is an organic compound belonging to the naphthalene derivative family. This substance features a naphthalene ring system substituted with a methyl group, a hydroxyl group, and a carboxylate ester functional group. The presence of the hydroxyl group contributes to its potential as a phenolic compound, which may exhibit antioxidant properties. The methyl ester functionality suggests that it can participate in various chemical reactions, including esterification and hydrolysis. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic naphthalene structure, while the hydroxyl group may enhance its solubility in polar solvents. Its structural characteristics may also impart specific biological activities, making it of interest in fields such as medicinal chemistry and materials science. Overall, methyl 4-hydroxy-6-methyl-naphthalene-2-carboxylate is a versatile compound with potential applications in various chemical and pharmaceutical contexts.
Formula:C13H12O3
InChI:InChI=1/C13H12O3/c1-8-3-4-9-6-10(13(15)16-2)7-12(14)11(9)5-8/h3-7,14H,1-2H3
Synonyms:- Methyl-4-hydroxy-6-methyl-2-naphthoat
- 2-Naphthalenecarboxylic acid,4-hydroxy-6-Methyl-,Methyl ester
- methyl 4-hydroxy-6-methyl-2-naphthoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.