CAS 127273-12-5
:3-(4-Chlorophenyl)-2-hydroxy-2-propenoic acid
Description:
3-(4-Chlorophenyl)-2-hydroxy-2-propenoic acid, also known as a derivative of cinnamic acid, is characterized by its unique structural features, including a hydroxyl group and a chlorophenyl substituent. This compound typically exhibits properties associated with both phenolic and carboxylic acid functionalities, which can influence its solubility, reactivity, and biological activity. The presence of the 4-chlorophenyl group enhances its lipophilicity and may contribute to its potential as a bioactive agent. It is likely to participate in various chemical reactions, such as esterification and acylation, due to its reactive carboxylic acid group. Additionally, the hydroxyl group can engage in hydrogen bonding, affecting its physical properties and interactions with other molecules. This compound may be of interest in pharmaceutical research, particularly for its potential therapeutic applications, as well as in materials science for its role in polymer synthesis. As with many organic compounds, safety and handling precautions should be observed due to its chemical nature.
Formula:C9H7ClO3
InChI:InChI=1S/C9H7ClO3/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-5,11H,(H,12,13)
InChI key:InChIKey=LJIZTSRZWZUBJE-UHFFFAOYSA-N
SMILES:C(=C(C(O)=O)O)C1=CC=C(Cl)C=C1
Synonyms:- 3-(4-Chlorophenyl)-2-hydroxy-2-propenoic acid
- 2-Propenoic acid, 3-(4-chlorophenyl)-2-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
