CAS 127274-92-4

2-Piperidinecarboxylic acid, 6-oxo-, ethyl ester

Description:

2-Piperidinecarboxylic acid, 6-oxo-, ethyl ester, also known by its CAS number 127274-92-4, is an organic compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group and an ester moiety, specifically an ethyl ester, which contributes to its solubility and reactivity. The presence of the 6-oxo group indicates that there is a carbonyl functional group at the sixth position of the piperidine ring, which can influence the compound's chemical behavior, including its acidity and potential for further reactions. Typically, compounds of this nature may exhibit moderate polarity, making them soluble in organic solvents while having limited solubility in water. They may also participate in various chemical reactions, such as esterification or amidation, due to the functional groups present. This compound could be of interest in pharmaceutical chemistry, particularly in the synthesis of biologically active molecules or as intermediates in organic synthesis.

Formula: C₈H₁₃NO₃

InChI: InChI=1S/C8H13NO3/c1-2-12-8(11)6-4-3-5-7(10)9-6/h6H,2-5H2,1H3,(H,9,10)

InChI key: InChIKey=MNUVAPMABSFWAR-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1NC(=O)CCC1

Synonyms:

• Ethyl 6-oxopiperidine-2-carboxylate
• 2-Piperidinecarboxylic acid, 6-oxo-, ethyl ester