CAS 1272755-11-9

D-Methionine, N-methyl-N-(phenylmethyl)-, methyl ester, hydrochloride (1:1)

Description:

D-Methionine, N-methyl-N-(phenylmethyl)-, methyl ester, hydrochloride (1:1) is a synthetic compound that belongs to the class of amino acid derivatives. It features a methionine backbone, which is an essential amino acid known for its role in protein synthesis and as a precursor for various biomolecules. The presence of the N-methyl and phenylmethyl groups indicates modifications that can influence its solubility, stability, and biological activity. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for pharmaceutical applications. This compound may exhibit properties such as antioxidant activity and potential neuroprotective effects, making it of interest in biochemical research and therapeutic development. Its specific interactions and efficacy would depend on the context of its use, including dosage and formulation. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or clinical settings.

Formula: C₁₄H₂₁NO₂S·ClH

InChI: InChI=1S/C14H21NO2S.ClH/c1-15(11-12-7-5-4-6-8-12)13(9-10-18-3)14(16)17-2;/h4-8,13H,9-11H2,1-3H3;1H/t13-;/m1./s1

InChI key: InChIKey=UAABAOCOIDJTRS-BTQNPOSSSA-N

SMILES: [C@H](N(CC1=CC=CC=C1)C)(C(OC)=O)CCSC.Cl

Synonyms:

• D-Methionine, N-methyl-N-(phenylmethyl)-, methyl ester, hydrochloride (1:1)

N-Benzyl-N-methyl-D-methionine methyl ester hydrochloride

CAS: 1272755-11-9

Formula: C₁₄H₂₂ClNO₂S

Purity: 99.0%

Molecular weight: 303.85

Ref: 10-F493557