CAS 1272755-12-0

D-Methionine, N-(phenylmethyl)-, methyl ester, hydrochloride (1:1)

Description:

D-Methionine, N-(phenylmethyl)-, methyl ester, hydrochloride (1:1) is a synthetic compound that belongs to the class of amino acid derivatives. It features a methionine backbone, which is an essential amino acid known for its role in protein synthesis and as a precursor for various biomolecules. The presence of the phenylmethyl group indicates that it has been modified to enhance its properties, potentially affecting its solubility and bioavailability. As a hydrochloride salt, it is likely to be more soluble in water, making it suitable for various applications in pharmaceuticals and biochemistry. The compound may exhibit specific biological activities, including antioxidant properties, and could be of interest in research related to metabolic processes or therapeutic applications. Its stability, reactivity, and interaction with biological systems would depend on its structural characteristics and the presence of functional groups. Overall, this compound represents a unique modification of methionine that may have implications in both research and potential therapeutic contexts.

Formula: C₁₃H₁₉NO₂S·ClH

InChI: InChI=1S/C13H19NO2S.ClH/c1-16-13(15)12(8-9-17-2)14-10-11-6-4-3-5-7-11;/h3-7,12,14H,8-10H2,1-2H3;1H/t12-;/m1./s1

InChI key: InChIKey=PELBNOHMQZOBAL-UTONKHPSSA-N

SMILES: [C@@H](C(OC)=O)(NCC1=CC=CC=C1)CCSC.Cl

Synonyms:

• D-Methionine, N-(phenylmethyl)-, methyl ester, hydrochloride (1:1)