
CAS 1272755-18-6: D-Asparagine, methyl ester, hydrochloride (1:1)
Description:D-Asparagine, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes the amino acid asparagine modified with a methyl ester group and combined with hydrochloric acid to form a hydrochloride salt. This compound is typically a white crystalline solid, soluble in water due to the presence of the hydrochloride, which enhances its solubility compared to the free base form. It is often used in biochemical research and pharmaceutical applications, particularly in studies involving amino acid metabolism and protein synthesis. The methyl ester modification can influence the compound's reactivity and bioavailability, making it useful in various synthetic pathways. As with many amino acid derivatives, it may exhibit specific biological activities, including potential roles in neurotransmission and cellular signaling. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C5H10N2O3·ClH
InChI:InChI=1S/C5H10N2O3.ClH/c1-10-5(9)3(6)2-4(7)8;/h3H,2,6H2,1H3,(H2,7,8);1H/t3-;/m1./s1
InChI key:InChIKey=QOMQXHIJXUDQSS-AENDTGMFSA-N
SMILES:Cl.O=C(N)CC(N)C(=O)OC
- Synonyms:
- D-Asparagine, methyl ester, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | D-Asparagine methyl ester hydrochloride REF: 10-F011425CAS: 1272755-18-6 | 90.0% | 115.00 €~773.00 € | Tue 15 Apr 25 |
![]() | (R)-Methyl 2,4-diaMino-4-oxobutanoate hydrochloride REF: IN-DA009YKKCAS: 1272755-18-6 | 95% | - - - | Discontinued product |
![]() | D-Asparagine Methyl Ester Hydrochloride REF: 3D-XAC75518CAS: 1272755-18-6 | Min. 95% | - - - | Discontinued product |

D-Asparagine methyl ester hydrochloride
Ref: 10-F011425
1g | 255.00 € | ||
5g | 773.00 € | ||
250mg | 115.00 € |

(R)-Methyl 2,4-diaMino-4-oxobutanoate hydrochloride
Ref: IN-DA009YKK
1g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |

D-Asparagine Methyl Ester Hydrochloride
Ref: 3D-XAC75518
1g | Discontinued | Request information | |
5g | Discontinued | Request information |