CymitQuimica logo

CAS 1272755-87-9

:

5,8-Diazaspiro[3.4]octan-6-one, 7-(3-bromophenyl)-

Description:
5,8-Diazaspiro[3.4]octan-6-one, 7-(3-bromophenyl)- is a chemical compound characterized by its spirocyclic structure, which includes a bicyclic framework featuring two nitrogen atoms in the ring system. The presence of the 3-bromophenyl group indicates that there is a bromine atom attached to a phenyl ring at the 7-position of the spiro compound, which can influence its reactivity and biological activity. This compound may exhibit properties typical of nitrogen-containing heterocycles, such as potential pharmacological effects, making it of interest in medicinal chemistry. The spiro structure contributes to its unique three-dimensional conformation, which can affect how it interacts with biological targets. Additionally, the presence of the carbonyl group (ketone) at the 6-position may play a role in its reactivity and stability. Overall, this compound's unique structural features suggest potential applications in drug development and other fields of chemistry.
Formula:C12H13BrN2O
InChI:InChI=1S/C12H13BrN2O/c13-9-4-1-3-8(7-9)10-11(16)15-12(14-10)5-2-6-12/h1,3-4,7,10,14H,2,5-6H2,(H,15,16)
InChI key:InChIKey=HZSRQZQNXLVVJI-UHFFFAOYSA-N
SMILES:O=C1NC2(NC1C3=CC(Br)=CC=C3)CCC2
Synonyms:
  • 7-(3-Bromophenyl)-5,8-diazaspiro[3.4]octan-6-one
  • 5,8-Diazaspiro[3.4]octan-6-one, 7-(3-bromophenyl)-
Found 2 products.