CAS 1272756-16-7

Spiro[cyclopentane-1,2′(1′H)-quinazoline]-5′-carbonitrile, 3′,4′-dihydro-4′-oxo-

Description:

Spiro[cyclopentane-1,2′(1′H)-quinazoline]-5′-carbonitrile, 3′,4′-dihydro-4′-oxo- is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both a cyclopentane and a quinazoline moiety. The presence of a carbonitrile group indicates that it contains a cyano functional group, contributing to its reactivity and potential applications in medicinal chemistry. The compound also features a diketone structure, which may influence its chemical behavior and interactions. Its spiro configuration suggests that it may exhibit interesting stereochemical properties, potentially affecting its biological activity. This compound is of interest in the field of drug discovery, particularly for its potential therapeutic applications, owing to the biological significance of quinazoline derivatives. The specific arrangement of atoms and functional groups in this molecule may lead to unique pharmacological properties, making it a candidate for further research in medicinal chemistry and related fields.

Formula: C₁₃H₁₃N₃O

InChI: InChI=1S/C13H13N3O/c14-8-9-4-3-5-10-11(9)12(17)16-13(15-10)6-1-2-7-13/h3-5,15H,1-2,6-7H2,(H,16,17)

InChI key: InChIKey=IROLGSVICKCBJQ-UHFFFAOYSA-N

SMILES: O=C1NC2(NC=3C1=C(C#N)C=CC3)CCCC2

Synonyms:

• Spiro[cyclopentane-1,2′(1′H)-quinazoline]-5′-carbonitrile, 3′,4′-dihydro-4′-oxo-
• 4-Oxospiro[1,2,3,4-tetrahydroquinazoline-2,1′-cyclopentane]-5-carbonitrile
• 4'-Oxo-3',4'-dihydro-1'H-spiro[cyclopentane-1,2'-quinazoline]-5'-carbonitrile

Spiro[cyclopentane-1,2'(1'H)-quinazoline]-5'-carbonitrile, 3',4'-dihydro-4'-oxo-

CAS: 1272756-16-7

Formula: C₁₃H₁₃N₃O

Purity: 95%

Molecular weight: 227.2618

Ref: IN-DA000WUZ