CAS 1272758-06-1

4(1H)-Quinolinone, 5,7-dichloro-2,3-dihydro-, hydrochloride (1:1)

Description:

4(1H)-Quinolinone, 5,7-dichloro-2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its quinolinone structure, which features a bicyclic aromatic system. This compound contains two chlorine substituents at the 5 and 7 positions of the quinolinone ring, contributing to its unique reactivity and potential biological activity. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility in water and may influence its pharmacokinetic properties. The dihydro form suggests that the compound has two additional hydrogen atoms, indicating a saturation level that can affect its stability and reactivity. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific interactions and applications would depend on further studies, including its mechanism of action and potential therapeutic uses. As with many quinolinone derivatives, it may also be investigated for its role in various biochemical pathways or as a lead compound in the synthesis of more complex molecules.

Formula: C₉H₇Cl₂NO·ClH

InChI: InChI=1S/C9H7Cl2NO.ClH/c10-5-3-6(11)9-7(4-5)12-2-1-8(9)13;/h3-4,12H,1-2H2;1H

InChI key: InChIKey=SQBOODDVTVHTSX-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CC(Cl)=C1)NCCC2=O.Cl

Synonyms:

• 4(1H)-Quinolinone, 5,7-dichloro-2,3-dihydro-, hydrochloride (1:1)