CymitQuimica logo

CAS 1272758-14-1

:

6-[[(4-Methoxyphenyl)sulfonyl]amino]-3-pyridinecarboxylic acid

Description:
6-[[(4-Methoxyphenyl)sulfonyl]amino]-3-pyridinecarboxylic acid, with the CAS number 1272758-14-1, is a chemical compound characterized by its complex structure, which includes a pyridine ring, a carboxylic acid group, and a sulfonamide moiety. This compound features a methoxy-substituted phenyl group attached to a sulfonyl group, which enhances its solubility and reactivity. The presence of the carboxylic acid group contributes to its acidic properties, making it potentially useful in various chemical reactions and applications. The sulfonamide functional group is known for its biological activity, often serving as a pharmacophore in medicinal chemistry. This compound may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological activities would depend on further empirical studies. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Overall, this compound represents a class of sulfonamide derivatives that are of interest in both synthetic and medicinal chemistry.
Formula:C13H12N2O5S
InChI:InChI=1S/C13H12N2O5S/c1-20-10-3-5-11(6-4-10)21(18,19)15-12-7-2-9(8-14-12)13(16)17/h2-8H,1H3,(H,14,15)(H,16,17)
InChI key:InChIKey=AIKYEVXVRVAMNT-UHFFFAOYSA-N
SMILES:S(NC1=CC=C(C(O)=O)C=N1)(=O)(=O)C2=CC=C(OC)C=C2
Synonyms:
  • 3-Pyridinecarboxylic acid, 6-[[(4-methoxyphenyl)sulfonyl]amino]-
  • 6-[[(4-Methoxyphenyl)sulfonyl]amino]-3-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.