CAS 1272758-27-6

1H-Indene-2-carboxylic acid, 2-amino-2,3-dihydro-5-(trifluoromethyl)-, ethyl ester, hydrochloride (1:1)

Description:

1H-Indene-2-carboxylic acid, 2-amino-2,3-dihydro-5-(trifluoromethyl)-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its indene structure, which is a bicyclic compound featuring a five-membered ring fused to a six-membered ring. The presence of a carboxylic acid group and an ethyl ester indicates that it can participate in various chemical reactions, such as esterification and hydrolysis. The trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The hydrochloride form suggests that the compound is a salt, which can improve its solubility in water and stability. This compound may exhibit properties typical of amino acids and esters, including potential applications in pharmaceuticals or agrochemicals. Its specific interactions and reactivity would depend on the functional groups present, and further studies would be necessary to elucidate its full chemical behavior and potential applications.

Formula: C₁₃H₁₄F₃NO₂·ClH

InChI: InChI=1S/C13H14F3NO2.ClH/c1-2-19-11(18)12(17)6-8-3-4-10(13(14,15)16)5-9(8)7-12;/h3-5H,2,6-7,17H2,1H3;1H

InChI key: InChIKey=FUCKCMVGIIHRJE-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1(N)CC=2C(C1)=CC=C(C(F)(F)F)C2.Cl

Synonyms:

• 1H-Indene-2-carboxylic acid, 2-amino-2,3-dihydro-5-(trifluoromethyl)-, ethyl ester, hydrochloride (1:1)