
CAS 1272758-30-1
:3-(1-Oxido-4-pyridinyl)-1,2,4-thiadiazol-5-amine
Description:
3-(1-Oxido-4-pyridinyl)-1,2,4-thiadiazol-5-amine is a chemical compound characterized by its unique structural features, which include a thiadiazole ring and a pyridine moiety. The presence of the thiadiazole ring contributes to its potential biological activity, as thiadiazoles are known for their diverse pharmacological properties. The compound contains an amine functional group, which can participate in hydrogen bonding and influence its solubility and reactivity. The oxo group attached to the pyridine enhances the electron-withdrawing characteristics of the molecule, potentially affecting its interaction with biological targets. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in medicinal chemistry. Its specific applications and efficacy would depend on further studies, including in vitro and in vivo evaluations. Overall, the combination of these functional groups suggests that 3-(1-Oxido-4-pyridinyl)-1,2,4-thiadiazol-5-amine could serve as a valuable lead compound in drug discovery and development.
Formula:C7H6N4OS
InChI:InChI=1S/C7H6N4OS/c8-7-9-6(10-13-7)5-1-3-11(12)4-2-5/h1-4H,(H2,8,9,10)
InChI key:InChIKey=SFBDKMIVAXXIGS-UHFFFAOYSA-N
SMILES:NC1=NC(C=2C=CN(=O)=CC2)=NS1
Synonyms:- 3-(1-Oxido-4-pyridinyl)-1,2,4-thiadiazol-5-amine
- 1,2,4-Thiadiazol-5-amine, 3-(1-oxido-4-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.