CAS 1272758-39-0

Benzenamine, 3,3′,3′′,3′′′-methtetrayltetrakis[6-bromo-

Description:

Benzenamine, 3,3′,3′′,3′′′-methtetrayltetrakis[6-bromo-] is a complex organic compound characterized by its multiple brominated aromatic amine structure. The presence of the amine functional group (-NH2) indicates potential basicity and reactivity, particularly in nucleophilic substitution reactions. The bromine substituents enhance the compound's electrophilic character, making it useful in various chemical syntheses and applications, including materials science and pharmaceuticals. The tetrakis structure suggests that the compound has multiple identical substituents, which can influence its physical properties, such as solubility and melting point. Additionally, the presence of multiple bromine atoms can impart significant stability to the compound, while also affecting its reactivity and interaction with other chemical species. Overall, this compound's unique structure and functional groups make it a subject of interest in organic chemistry and related fields.

Formula: C₂₅H₂₀Br₄N₄

InChI: InChI=1S/C25H20Br4N4/c26-17-5-1-13(9-21(17)30)25(14-2-6-18(27)22(31)10-14,15-3-7-19(28)23(32)11-15)16-4-8-20(29)24(33)12-16/h1-12H,30-33H2

InChI key: InChIKey=ASPKVLUOXOJINS-UHFFFAOYSA-N

SMILES: C(C1=CC(N)=C(Br)C=C1)(C2=CC(N)=C(Br)C=C2)(C3=CC(N)=C(Br)C=C3)C4=CC(N)=C(Br)C=C4

Synonyms:

• 5,5′,5′′,5′′′-Methanetetrayltetrakis(2-bromoaniline)
• Benzenamine, 3,3′,3′′,3′′′-methtetrayltetrakis[6-bromo-