CAS 127285-54-5

6,7-dimethoxyquinolin-4(3H)-one

Description:

6,7-Dimethoxyquinolin-4(3H)-one is a chemical compound characterized by its quinoline structure, which features a bicyclic aromatic system. This compound contains two methoxy groups (-OCH3) at the 6 and 7 positions of the quinoline ring, contributing to its unique chemical properties and potential biological activity. The presence of the carbonyl group (C=O) at the 4-position enhances its reactivity and may influence its interaction with biological targets. This compound is often studied for its potential pharmacological applications, including antimicrobial and anticancer properties, due to the quinoline core's known bioactivity. Additionally, its solubility and stability can be influenced by the methoxy substituents, making it a subject of interest in medicinal chemistry. The molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced efficacy or selectivity. Overall, 6,7-dimethoxyquinolin-4(3H)-one represents a significant compound in the field of organic and medicinal chemistry, with ongoing research into its applications and mechanisms of action.

Formula: C₁₁H₁₁NO₃

InChI: InChI=1/C11H11NO3/c1-14-10-5-7-8(6-11(10)15-2)12-4-3-9(7)13/h4-6H,3H2,1-2H3

SMILES: COc1cc2c(cc1OC)N=CCC2=O

Synonyms:

• 4(3H)-quinolinone, 6,7-dimethoxy-
• 6,7-Dimethoxy-1H-quinolin-4-one
• 6,7-Dimethoxy-3H-quinolin-4-one
• 6,7-Dimethoxyquinolin-4(3H)-one

4(1H)-Quinolinone, 6,7-dimethoxy-

CAS: 127285-54-5

Formula: C₁₁H₁₁NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 205.2099

Ref: IN-DA000WVU

6,7-Dimethoxy-1H-Quinolin-4-One

CAS: 127285-54-5

6,7-Dimethoxy-1H-Quinolin-4-One

Purity: 98%

Molecular weight: 205.21g/mol

Ref: 54-OR1011966