CAS 127292-42-6
:α-Ethyl-1,3-benzodioxole-5-methanamine
Description:
α-Ethyl-1,3-benzodioxole-5-methanamine, identified by its CAS number 127292-42-6, is a chemical compound that features a benzodioxole structure, which is characterized by a fused benzene and dioxole ring system. This compound contains an ethyl group and a methanamine functional group, contributing to its unique reactivity and potential biological activity. Typically, compounds of this nature may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological systems, making them of interest in medicinal chemistry and pharmacology. The presence of the amine group suggests that it may participate in hydrogen bonding, influencing its physical properties and reactivity. Additionally, the specific arrangement of substituents can affect its electronic properties, potentially impacting its behavior in chemical reactions. As with many organic compounds, safety and handling precautions are essential, particularly regarding its potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its characteristics and applications in various fields.
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c1-2-8(11)7-3-4-9-10(5-7)13-6-12-9/h3-5,8H,2,6,11H2,1H3
InChI key:InChIKey=VEOUOCLRLNJOLJ-UHFFFAOYSA-N
SMILES:C(CC)(N)C=1C=C2C(=CC1)OCO2
Synonyms:- (1-(Benzodioxol-5-yl)propyl)amine
- 1-Benzo[1,3]dioxol-5-yl-propylamine
- α-Ethyl-1,3-benzodioxole-5-methanamine
- 1-(2H-1,3-Benzodioxol-5-yl)propan-1-amine
- 1,3-Benzodioxole-5-methanamine, α-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
