CAS 1273-73-0

Bromoferrocene

Description:

Bromoferrocene is an organometallic compound characterized by the presence of a ferrocene structure, which consists of a central iron atom sandwiched between two cyclopentadienyl rings, with a bromine substituent on one of the cyclopentadienyl rings. This compound typically exhibits a bright orange to red color, indicative of its ferrocene-like properties. Bromoferrocene is known for its stability and solubility in organic solvents, making it useful in various chemical applications, including as a reagent in organic synthesis and as a precursor for further functionalization. The presence of the bromine atom introduces electrophilic characteristics, allowing for nucleophilic substitution reactions. Additionally, bromoferrocene can participate in redox reactions, showcasing the electrochemical properties typical of ferrocene derivatives. Its unique structure and reactivity make it a valuable compound in the fields of organometallic chemistry and materials science. Safety precautions should be observed when handling this compound, as with many organometallic substances, due to potential toxicity and reactivity.

Formula: C₁₀H₉BrFe

InChI: InChI=1/C5H4Br.C5H5.Fe/c6-5-3-1-2-4-5;1-2-4-5-3-1;/h1-4H;1-5H;/rC10H9BrFe/c11-9-6-3-7-10(9)12-8-4-1-2-5-8/h1-8,10H

SMILES: C1=CC(C=C1)[Fe]C1C=CC=C1Br

Synonyms:

• (Bromocyclopentadienyl)Cyclopentadienyl-Iron

Bromoferrocene

CAS: 1273-73-0

Formula: C₁₀H₉BrFe

Purity: >95.0%(GC)(T)

Color and Shape: Light yellow to Brown powder to crystal

Molecular weight: 264.93

Ref: 3B-B3476

Bromoferrocene, 97%

CAS: 1273-73-0

Bromoferrocene, 97%

Formula: C₁₀H₉BrFe

Purity: 97%

Color and Shape: orange solid

Molecular weight: 264.93

Ref: 08-26-0460

Ferrocene, bromo-

CAS: 1273-73-0

Formula: C₁₀BrFe

Purity: 98%

Color and Shape: Solid

Molecular weight: 255.8560

Ref: IN-DA000WWQ

Bromoferrocene

CAS: 1273-73-0

Bromoferrocene

Purity: 98%

Color and Shape: Light Brown/Red Solid

Molecular weight: 264.93g/mol

Ref: 54-OR315061

Bromoferrocene

CAS: 1273-73-0

Bromoferrocene is a ligand that binds to the ferrocenecarboxylic acid skeleton. It is an aromatic hydrocarbon that has been shown to be a potent inhibitor of cervical cancer proliferation. Bromoferrocene was synthesized by a Friedel-Crafts reaction between styrene and hydrobromic acid. The bromine atom in this compound is electron-withdrawing and therefore has radical character, which makes it a reactive molecule with potential for biological activity. Bromoferrocene is chiral and thus can exist as two enantiomers - one with R configuration, the other L.

Formula: C₁₀H₉BrFe

Purity: 90%Nmr

Molecular weight: 264.93 g/mol

Ref: 3D-FB152438