CAS 1273-74-1

5-chlorocyclopenta-1,3-diene; cyclopentane; iron

Description:

5-Chlorocyclopenta-1,3-diene, with the CAS number 1273-74-1, is an organic compound characterized by its cyclopentene structure with a chlorine substituent at the 5-position and two double bonds in a conjugated system. This compound is typically a colorless to pale yellow liquid and exhibits a distinctive odor. Its reactivity is influenced by the presence of the double bonds, making it susceptible to electrophilic addition reactions. The chlorine atom introduces additional polarity, which can affect its solubility in various solvents. In terms of stability, 5-chlorocyclopenta-1,3-diene can undergo polymerization or dimerization under certain conditions. When discussing its interaction with iron, it is important to note that transition metals like iron can catalyze reactions involving diene compounds, potentially leading to complexation or other transformations. Overall, this compound is of interest in organic synthesis and materials science due to its unique structural features and reactivity.

Formula: C₁₀H₉ClFe

InChI: InChI=1/C5H4Cl.C5H5.Fe/c6-5-3-1-2-4-5;1-2-4-5-3-1;/h1-4H;1-5H;/q-1;-5;

SMILES: C1=C[CH-]C(=C1)Cl.[CH-]1[CH-][CH-][CH-][CH-]1.[Fe]