CAS 127321-51-1
:7-(diethylamino)-3-(hydroxymethyl)-4-methyl-2H-chromen-2-one
Description:
7-(Diethylamino)-3-(hydroxymethyl)-4-methyl-2H-chromen-2-one, with CAS number 127321-51-1, is a synthetic organic compound belonging to the class of coumarins. This substance features a chromenone core, characterized by a benzopyran structure, which is known for its diverse biological activities. The presence of a diethylamino group enhances its solubility and potential interaction with biological systems, while the hydroxymethyl and methyl substituents contribute to its chemical reactivity and stability. Coumarins are often recognized for their fluorescence properties and can exhibit various pharmacological effects, including anticoagulant, anti-inflammatory, and antimicrobial activities. The specific structural modifications in this compound may influence its efficacy and selectivity in biological applications. Additionally, the compound's solubility, melting point, and spectral properties can be influenced by its substituents, making it a subject of interest in medicinal chemistry and drug development. Overall, this compound exemplifies the structural diversity and potential utility of coumarin derivatives in pharmaceutical research.
Formula:C15H19NO3
InChI:InChI=1/C15H19NO3/c1-4-16(5-2)11-6-7-12-10(3)13(9-17)15(18)19-14(12)8-11/h6-8,17H,4-5,9H2,1-3H3
SMILES:CCN(CC)c1ccc2c(C)c(CO)c(=O)oc2c1
Synonyms:- 7-Diethylamino-3-hydroxymethyl-4-methyl-chromen-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-1-Benzopyran-2-one, 7-(diethylamino)-3-(hydroxymethyl)-4-methyl-
CAS:Formula:C15H19NO3Molecular weight:261.3163
