
CAS 127324-62-3
:1,2-Dihydro-2-thioxo-4-pyridinecarbothioamide
Description:
1,2-Dihydro-2-thioxo-4-pyridinecarbothioamide is a chemical compound characterized by its unique structural features, which include a pyridine ring and a thioxo group. This compound typically exhibits properties associated with thioamide functionalities, such as potential reactivity in nucleophilic substitution reactions and the ability to form coordination complexes with metal ions. The presence of the thioxo group contributes to its potential as a biological or pharmacological agent, as thioamides are often investigated for their antimicrobial and antifungal properties. Additionally, the compound may display moderate solubility in polar solvents, influenced by the presence of the pyridine nitrogen, which can engage in hydrogen bonding. Its molecular structure suggests that it may participate in various chemical reactions, including condensation and cyclization, making it of interest in synthetic organic chemistry. Overall, 1,2-Dihydro-2-thioxo-4-pyridinecarbothioamide represents a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C6H6N2S2
InChI:InChI=1S/C6H6N2S2/c7-6(10)4-1-2-8-5(9)3-4/h1-3H,(H2,7,10)(H,8,9)
InChI key:InChIKey=ARHOCUIYQBELDW-UHFFFAOYSA-N
SMILES:C(N)(=S)C1=CC(=S)NC=C1
Synonyms:- 4-Pyridinecarbothioamide, 1,2-dihydro-2-thioxo-
- 2-Mercaptopyridine-4-carbothioamide
- 1,2-Dihydro-2-thioxo-4-pyridinecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.