CAS 127326-78-7
:Benzene, 4-bromo-2-fluoro-1-(pentyloxy)-
Description:
Benzene, 4-bromo-2-fluoro-1-(pentyloxy)-, also known by its CAS number 127326-78-7, is an organic compound characterized by a benzene ring substituted with a bromine atom at the para position, a fluorine atom at the meta position, and a pentyloxy group at the ortho position. This compound exhibits typical properties of aromatic compounds, including stability due to resonance and a relatively low reactivity compared to aliphatic compounds. The presence of the bromine and fluorine substituents introduces halogen characteristics, which can influence the compound's reactivity, polarity, and potential for hydrogen bonding. The pentyloxy group contributes to the compound's hydrophobic nature and can affect its solubility in organic solvents. Overall, this compound may be of interest in various fields, including materials science and medicinal chemistry, due to its unique structural features and potential applications in synthesis and as a building block for more complex molecules.
Formula:C11H14BrFO
InChI:InChI=1S/C11H14BrFO/c1-2-3-4-7-14-11-6-5-9(12)8-10(11)13/h5-6,8H,2-4,7H2,1H3
InChI key:InChIKey=FCYFSULPHRADAI-UHFFFAOYSA-N
SMILES:O(CCCCC)C1=C(F)C=C(Br)C=C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.