CAS 127340-37-8
:3-Thiophenecarboxylic acid, homopolymer
Description:
3-Thiophenecarboxylic acid, homopolymer, is a polymer derived from the polymerization of 3-thiophenecarboxylic acid monomers. This substance exhibits characteristics typical of thiophene-based polymers, including good thermal stability and electrical conductivity, making it suitable for applications in organic electronics and conductive materials. The presence of carboxylic acid functional groups contributes to its potential for further chemical modifications, enhancing its versatility in various applications. The polymer's structure allows for π-π stacking interactions, which can improve its mechanical properties and facilitate charge transport. Additionally, the solubility of the polymer can vary depending on the degree of polymerization and the presence of side groups, influencing its processing and application in coatings, sensors, and other advanced materials. Overall, 3-Thiophenecarboxylic acid, homopolymer, represents a significant class of materials with promising properties for use in innovative chemical and electronic applications.
Formula:(C5H4O2S)x
InChI:InChI=1S/C5H4O2S/c6-5(7)4-1-2-8-3-4/h1-3H,(H,6,7)
InChI key:InChIKey=YNVOMSDITJMNET-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=CSC1
Synonyms:- Poly(3-carboxythiophene)
- 3-Thiophenecarboxylic acid, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
