CAS 127342-09-0

Pyrrolidine, 3-(1-naphthalenyloxy)-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-(1-naphthalenyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of the 1-naphthalenyloxy group indicates that the compound has a naphthalene moiety attached via an ether linkage, contributing to its aromatic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. This compound may exhibit biological activity, potentially acting as a ligand or modulator in biochemical pathways. Its molecular interactions can be influenced by the naphthalenyl group, which may affect its pharmacokinetics and pharmacodynamics. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a unique combination of structural features that may confer specific properties relevant to research and development in medicinal chemistry.

Formula: C₁₄H₁₅NO·ClH

InChI: InChI=1S/C14H15NO.ClH/c1-2-6-13-11(4-1)5-3-7-14(13)16-12-8-9-15-10-12;/h1-7,12,15H,8-10H2;1H

InChI key: InChIKey=AWZNCWLOBNAZQU-UHFFFAOYSA-N

SMILES: O(C=1C2=C(C=CC1)C=CC=C2)C3CCNC3.Cl

Synonyms:

• Pyrrolidine, 3-(1-naphthalenyloxy)-, hydrochloride
• Pyrrolidine, 3-(1-naphthalenyloxy)-, hydrochloride (1:1)
• 1-Naphthyl 3-pyrrolidinyl ether hydrochloride