CAS 127342-10-3

Pyrrolidine, 3-(2-naphthalenyloxy)-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-(2-naphthalenyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine core, which is a five-membered saturated heterocyclic amine. The presence of the 2-naphthalenyloxy group indicates that it has a naphthalene moiety linked via an ether bond to the pyrrolidine ring, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, potentially acting as a ligand for certain receptors or enzymes, although specific biological activities would depend on further empirical studies. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in biological systems. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.

Formula: C₁₄H₁₅NO·ClH

InChI: InChI=1S/C14H15NO.ClH/c1-2-4-12-9-13(6-5-11(12)3-1)16-14-7-8-15-10-14;/h1-6,9,14-15H,7-8,10H2;1H

InChI key: InChIKey=QJVSPNKJVASFJC-UHFFFAOYSA-N

SMILES: O(C1=CC2=C(C=C1)C=CC=C2)C3CCNC3.Cl

Synonyms:

• Pyrrolidine, 3-(2-naphthalenyloxy)-, hydrochloride (1:1)
• 2-Naphthyl 3-pyrrolidinyl ether hydrochloride
• Pyrrolidine, 3-(2-naphthalenyloxy)-, hydrochloride