CymitQuimica logo

CAS 127346-42-3

:

4-AMINO-2-METHYLTHIO-5-NITROTHIAZOLE

Description:
4-Amino-2-methylthio-5-nitrothiazole is a heterocyclic organic compound characterized by its thiazole ring, which contains both sulfur and nitrogen atoms. This compound features an amino group (-NH2), a methylthio group (-S-CH3), and a nitro group (-NO2) attached to the thiazole structure, contributing to its unique chemical properties. It is typically a yellow to orange solid, and its molecular structure allows for various interactions, making it of interest in pharmaceutical and agricultural applications. The presence of the nitro group suggests potential reactivity, particularly in reduction reactions, while the amino group can participate in hydrogen bonding and nucleophilic substitutions. This compound may exhibit biological activity, which has led to research into its potential uses in drug development or as a pesticide. Safety data should be consulted for handling and exposure risks, as compounds with nitro and amino functionalities can have specific health and environmental implications.
Formula:C4H5N3O2S2
InChI:InChI=1/C4H5N3O2S2/c1-10-4-6-2(5)3(11-4)7(8)9/h5H2,1H3
SMILES:CSc1nc(c(N(=O)=O)s1)N
Synonyms:
  • 2-(Methylsulfanyl)-5-nitro-1,3-thiazol-4-amine
  • 4-Thiazolamine, 2-(methylthio)-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.