CAS 127356-16-5

4-Methoxy-2,3-pyridinediamine

Description:

4-Methoxy-2,3-pyridinediamine, with the CAS number 127356-16-5, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two amino groups (-NH2) and a methoxy group (-OCH3) attached to the pyridine ring, influencing its reactivity and solubility. The presence of the methoxy group enhances its lipophilicity, while the amino groups can participate in hydrogen bonding and nucleophilic reactions. 4-Methoxy-2,3-pyridinediamine is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its chemical properties make it of interest in various fields, including medicinal chemistry, where it may serve as a building block for pharmaceuticals or as a ligand in coordination chemistry. Additionally, the compound's functional groups suggest potential applications in biological systems, possibly as a precursor for drug synthesis or as a research tool in biochemical studies. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₆H₉N₃O

InChI: InChI=1S/C6H9N3O/c1-10-4-2-3-9-6(8)5(4)7/h2-3H,7H2,1H3,(H2,8,9)

InChI key: InChIKey=UYMYMHQOWIHQKU-UHFFFAOYSA-N

SMILES: O(C)C=1C(N)=C(N)N=CC1

Synonyms:

• 2,3-Diamino-4-methoxypyridine
• 2,3-Pyridinediamine, 4-methoxy-
• 4-Methoxy-2,3-pyridinediamine