CAS 1273566-33-8
:3-Fluoro-3-pyrrolidinemethanol
Description:
3-Fluoro-3-pyrrolidinemethanol is a chemical compound characterized by the presence of a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The molecule features a hydroxymethyl group (-CH2OH) and a fluorine atom attached to the third carbon of the pyrrolidine ring, contributing to its unique reactivity and properties. This compound is typically classified as an amine and alcohol due to the presence of both nitrogen and hydroxyl functional groups. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the fluorine atom can enhance metabolic stability and bioactivity. The compound's solubility, stability, and reactivity can be influenced by the presence of the fluorine atom and the hydroxymethyl group, making it a subject of interest in various chemical research fields. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity and reactivity.
Formula:C5H10FNO
InChI:InChI=1S/C5H10FNO/c6-5(4-8)1-2-7-3-5/h7-8H,1-4H2
InChI key:InChIKey=RWOGZQDBFUFMSJ-UHFFFAOYSA-N
SMILES:C(O)C1(F)CCNC1
Synonyms:- 3-Fluoro-3-(hydroxymethyl)pyrrolidine
- 3-Pyrrolidinemethanol, 3-fluoro-
- (3-Fluoropyrrolidin-3-yl)methanol
- 3-Fluoro-3-pyrrolidinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.