
CAS 1273577-15-3
:4,6-Dichloro-3-ethyl-1H-pyrazolo[3,4-d]pyrimidine
Description:
4,6-Dichloro-3-ethyl-1H-pyrazolo[3,4-d]pyrimidine is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which features a fused ring system containing nitrogen atoms. This compound typically exhibits a pale to light yellow crystalline appearance. The presence of two chlorine atoms at the 4 and 6 positions contributes to its reactivity and potential biological activity, while the ethyl group at the 3 position influences its solubility and lipophilicity. It is often studied for its potential applications in medicinal chemistry, particularly as a scaffold for developing pharmaceuticals due to its ability to interact with various biological targets. The compound's molecular structure allows for diverse substitution patterns, which can be explored to enhance its pharmacological properties. Additionally, its stability under standard laboratory conditions makes it suitable for further chemical modifications and investigations. As with many heterocycles, it may exhibit interesting electronic properties, making it a subject of interest in both organic synthesis and material science.
Formula:C7H6Cl2N4
InChI:InChI=1S/C7H6Cl2N4/c1-2-3-4-5(8)10-7(9)11-6(4)13-12-3/h2H2,1H3,(H,10,11,12,13)
InChI key:InChIKey=TZGPDZJRRVHFLD-UHFFFAOYSA-N
SMILES:C(C)C=1C=2C(NN1)=NC(Cl)=NC2Cl
Synonyms:- 4,6-Dichloro-3-ethyl-1H-pyrazolo[3,4-d]pyrimidine
- 1H-Pyrazolo[3,4-d]pyrimidine, 4,6-dichloro-3-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.