CAS 1273577-24-4

4-Isoxazolecarboxamide, 5-amino-, sulfate (1:1)

Description:

4-Isoxazolecarboxamide, 5-amino-, sulfate (1:1) is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features an amide functional group, indicating the presence of a carbonyl group (C=O) directly attached to a nitrogen atom. The sulfate component suggests that the compound is a salt formed with sulfuric acid, which can influence its solubility and reactivity. The presence of the amino group (–NH2) indicates potential for hydrogen bonding and reactivity, making it of interest in various biochemical applications. This compound may exhibit properties such as moderate to high solubility in polar solvents, and its biological activity could be linked to its structural features, potentially making it relevant in medicinal chemistry or pharmacology. As with many chemical substances, safety data and handling precautions should be considered, particularly due to the presence of nitrogen and sulfur in its structure.

Formula: C₄H₅N₃O₂·H₂O₄S

InChI: InChI=1S/C4H5N3O2.H2O4S/c5-3(8)2-1-7-9-4(2)6;1-5(2,3)4/h1H,6H2,(H2,5,8);(H2,1,2,3,4)

InChI key: InChIKey=IZAWQSSFWTZPAZ-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=C(N)ON=C1.S(=O)(=O)(O)O

Synonyms:

• 4-Isoxazolecarboxamide, 5-amino-, sulfate (1:1)

4-Isoxazolecarboxamide, 5-amino-, sulfate (1:1)

CAS: 1273577-24-4

Formula: C₄H₇N₃O₆S

Purity: 97%

Molecular weight: 225.1799

Ref: IN-DA000WYE

5-Aminoisoxazole-4-carboxamide sulfate

CAS: 1273577-24-4

Formula: C₄H₇N₃O₆S

Purity: >97%

Molecular weight: 225.18

Ref: 10-F445998