CAS 1273577-40-4

2-(Methylsulfonyl)thieno[2,3-d]pyrimidin-4(1H)-one

Description:

2-(Methylsulfonyl)thieno[2,3-d]pyrimidin-4(1H)-one is a heterocyclic organic compound characterized by its unique structural features, which include a thieno[2,3-d]pyrimidine core and a methylsulfonyl functional group. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents, reflecting its polar nature due to the sulfonyl group. The presence of the thieno and pyrimidine rings contributes to its potential biological activity, making it of interest in pharmaceutical research. It may exhibit properties such as anti-inflammatory or anti-cancer activities, although specific biological effects would depend on further empirical studies. The compound's molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its reactivity and stability. As with many heterocycles, it may also participate in diverse chemical reactions, making it a valuable compound in synthetic organic chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₇H₆N₂O₃S₂

InChI: InChI=1S/C7H6N2O3S2/c1-14(11,12)7-8-5(10)4-2-3-13-6(4)9-7/h2-3H,1H3,(H,8,9,10)

InChI key: InChIKey=QNYITTVFONTYGV-UHFFFAOYSA-N

SMILES: O=C1C2=C(NC(S(C)(=O)=O)=N1)SC=C2

Synonyms:

• Thieno[2,3-d]pyrimidin-4(1H)-one, 2-(methylsulfonyl)-
• 2-(Methylsulfonyl)thieno[2,3-d]pyrimidin-4(1H)-one