CAS 1273653-91-0

5,7-Dibromo-2,3-dihydro-3-benzofuranamine

Description:

5,7-Dibromo-2,3-dihydro-3-benzofuranamine is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and two bromine substituents at the 5 and 7 positions. This compound features a dihydrobenzofuran framework, indicating the presence of a saturated ring system that contributes to its stability and reactivity. The amine functional group enhances its potential for hydrogen bonding and reactivity in various chemical reactions. The presence of bromine atoms typically increases the compound's reactivity due to the electronegative nature of bromine, which can influence both nucleophilic and electrophilic interactions. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its specific properties, such as solubility, melting point, and spectral characteristics, would depend on the molecular interactions and the environment in which it is studied. Overall, 5,7-Dibromo-2,3-dihydro-3-benzofuranamine represents a complex organic molecule with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₈H₇Br₂NO

InChI: InChI=1S/C8H7Br2NO/c9-4-1-5-7(11)3-12-8(5)6(10)2-4/h1-2,7H,3,11H2

InChI key: InChIKey=VUOWVPWNLZNXID-UHFFFAOYSA-N

SMILES: BrC1=C2C(=CC(Br)=C1)C(N)CO2

Synonyms:

• 5,7-Dibromo-2,3-dihydro-3-benzofuranamine
• 3-Benzofuranamine, 5,7-dibromo-2,3-dihydro-