CAS 127373-66-4: SIVELESTAT
Description:Sivelestat, with the CAS number 127373-66-4, is a synthetic small molecule that functions primarily as a selective inhibitor of neutrophil elastase, an enzyme involved in the inflammatory response. It is characterized by its ability to modulate inflammatory processes, particularly in conditions such as acute respiratory distress syndrome (ARDS) and other inflammatory diseases. Sivelestat exhibits a favorable pharmacokinetic profile, allowing for effective systemic absorption and distribution. Its mechanism of action involves the inhibition of neutrophil elastase, which helps to reduce tissue damage caused by excessive neutrophil activity during inflammation. The compound has been studied for its potential therapeutic benefits in various clinical settings, particularly in critical care medicine. Additionally, Sivelestat is known for its relatively low toxicity profile, making it a candidate for further research in the management of inflammatory conditions. Overall, Sivelestat represents a significant advancement in the development of targeted therapies aimed at mitigating the effects of inflammation in various pathological states.
Formula:C20H22N2O7S
InChI:InChI=1S/C20H22N2O7S/c1-20(2,3)19(26)29-13-8-10-14(11-9-13)30(27,28)22-16-7-5-4-6-15(16)18(25)21-12-17(23)24/h4-11,22H,12H2,1-3H3,(H,21,25)(H,23,24)
InChI key:InChIKey=BTGNGJJLZOIYID-UHFFFAOYSA-N
SMILES:O=C(O)CNC(=O)C=1C=CC=CC1NS(=O)(=O)C2=CC=C(OC(=O)C(C)(C)C)C=C2
- Synonyms:
- 127373-66-4
- 2-(2-(4-(Pivaloyloxy)phenylsulfonamido)benzamido)acetic acid
- 2-[[2-[[4-(2,2-Dimethylpropanoyloxy)Phenyl]Sulfonylamino]Benzoyl]Amino]Acetic Acid
- Ei 546
- Glycine, N-[2-[[[4-(2,2-dimethyl-1-oxopropoxy)phenyl]sulfonyl]amino]benzoyl]-
- Ly 544349
- N-{2-[({4-[(2,2-Dimethylpropanoyl)oxy]phenyl}sulfonyl)amino]benzoyl}glycine
- Ono 5046
- Propanoic Acid, 2,2-Dimethyl-, 4-[[[2-[[(Carboxymethyl)Amino]Carbonyl]Phenyl]Amino]Sulfonyl]Phenyl Ester
- o-(p-Hydroxybenzenesulfonamido)hippuric Acid Pivalate (Ester)
- See more synonyms
- Sivelestat
![Propanoic acid, 2,2-dimethyl-, 4-[[[2-[[(carboxymethyl)amino]carbonyl]phenyl]amino]sulfonyl]phenyl…](https://static.cymitquimica.com/products/IN/thumb/DA000WZW.jpg)
