CAS 127378-32-9
:(5Z)-5-(2-hydroxy-5-methoxybenzylidene)-2-thioxo-1,3-thiazolidin-4-one
Description:
The chemical substance known as (5Z)-5-(2-hydroxy-5-methoxybenzylidene)-2-thioxo-1,3-thiazolidin-4-one, with the CAS number 127378-32-9, is a thiazolidinone derivative characterized by its thiazolidine ring structure, which incorporates a thione functional group. This compound features a benzylidene moiety substituted with a hydroxy and methoxy group, contributing to its potential biological activity. The presence of the thioxo group suggests that it may exhibit properties typical of thioketones, such as reactivity towards nucleophiles. The hydroxyl and methoxy substituents can influence the compound's solubility, polarity, and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, thiazolidinones are often studied for their pharmacological properties, including anti-inflammatory and antimicrobial activities. The specific stereochemistry indicated by the (5Z) configuration may also play a crucial role in the compound's biological efficacy and mechanism of action. Overall, this compound represents a unique structure with potential applications in drug development and therapeutic research.
Formula:C11H9NO3S2
InChI:InChI=1/C11H9NO3S2/c1-15-7-2-3-8(13)6(4-7)5-9-10(14)12-11(16)17-9/h2-5,13H,1H3,(H,12,14,16)/b9-5-
SMILES:COc1ccc(c(c1)/C=C\1/C(=NC(=S)S1)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(2-Hydroxy-5-methoxybenzylidene)-2-thioxothiazolidin-4-one
CAS:Formula:C11H9NO3S2Molecular weight:267.3241
