CymitQuimica logo

CAS 127393-89-9

:

decarestrictine D

Description:
Decarestrictine D, with the CAS number 127393-89-9, is a natural product belonging to the class of compounds known as polyketides. It is primarily derived from certain species of fungi, particularly those in the genus *Penicillium*. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Decarestrictine D has garnered interest in the field of medicinal chemistry due to its potential antimicrobial and cytotoxic properties, making it a candidate for further research in drug development. Its mechanism of action and specific interactions with biological targets are subjects of ongoing investigation. Additionally, the compound's stability, solubility, and reactivity are important factors that influence its application in various scientific studies. Overall, decarestrictine D represents a fascinating area of study within natural product chemistry, with implications for pharmacology and therapeutic applications.
Formula:C10H16O5
InChI:InChI=1/C10H16O5/c1-6-4-7(11)2-3-8(12)9(13)5-10(14)15-6/h2-3,6-9,11-13H,4-5H2,1H3/b3-2-/t6-,7-,8+,9+/m1/s1
Synonyms:
  • Tuckolide
  • (4S,5S,6Z,8S,10R)-4,5,8-trihydroxy-10-methyl-3,4,5,8,9,10-hexahydro-2H-oxecin-2-one
  • Decarestrictine D
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.