CAS 1274-06-2

1,1'-DIBUTYRYLFERROCENE

Description:

1,1'-Dibutyrylferrocene is an organometallic compound characterized by its unique structure, which consists of two butyryl groups attached to a ferrocene moiety. Ferrocene itself is a metallocene, featuring a sandwich-like arrangement of iron (Fe) between two cyclopentadienyl anions. This compound exhibits notable stability and solubility in organic solvents due to the presence of the butyryl groups, which enhance its lipophilicity. The presence of the carbonyl groups in the butyryl moieties contributes to its reactivity, allowing for potential applications in organic synthesis and materials science. Additionally, 1,1'-dibutyrylferrocene can exhibit interesting electrochemical properties, making it a subject of study in the field of redox chemistry. Its unique characteristics may also lend themselves to applications in catalysis and as a building block for more complex molecular architectures. Overall, 1,1'-dibutyrylferrocene is a versatile compound with potential utility in various chemical research areas.

Formula: C₁₈H₂₂FeO₂

InChI: InChI=1/2C9H11O.Fe/c2*1-2-5-9(10)8-6-3-4-7-8;/h2*3-4,6-7H,2,5H2,1H3;/rC18H22FeO2/c1-3-7-17(20)13-9-5-11-15(13)19-16-12-6-10-14(16)18(21)8-4-2/h5-6,9-12,15-16H,3-4,7-8H2,1-2H3

SMILES: CCCC(=O)C1=CC=CC1[Fe]C1C=CC=C1C(=O)CCC

Synonyms:

• Ferrocene, 1,1'-bis(1-oxobutyl)-
• Bis(2-Butanoylcyclopenta-2,4-Dien-1-Yl)Iron
• 1,1'-Dibutyrylferrocene

1,1'-Dibutyrylferrocene

CAS: 1274-06-2

Formula: C₁₈H₂₂FeO₂

Purity: >98.0%(GC)

Color and Shape: Amber to Brown powder to crystal

Molecular weight: 326.22

Ref: 3B-D2951

1,1′-Bis(1-oxobutyl)ferrocene

CAS: 1274-06-2

Formula: C₁₈H₂₂FeO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 326.2111

Ref: IN-DA000X1M

1,1'-Dibutyrylferrocene

CAS: 1274-06-2

1,1'-Dibutyrylferrocene

Purity: 98%

Molecular weight: 326.22g/mol

Ref: 54-IN12562