CAS 127414-85-1
:Calystegine B2
Description:
Calystegine B2 is a bicyclic alkaloid primarily derived from the plant genus Calystegia, which belongs to the Convolvulaceae family. This compound is characterized by its unique structure, featuring a bicyclic framework that includes a piperidine ring. Calystegine B2 is known for its potential biological activities, including its role as an inhibitor of certain glycosidases, which may have implications in pharmacological applications, particularly in the context of glycosylation processes. The compound is typically found in various plant tissues and has garnered interest for its potential effects on human health, particularly in relation to metabolic disorders. Its solubility properties and stability under different conditions can vary, influencing its extraction and application in research. As with many alkaloids, Calystegine B2 may exhibit a range of physiological effects, necessitating further investigation to fully understand its mechanisms of action and potential therapeutic uses. Overall, Calystegine B2 represents a fascinating subject of study within the field of natural products and medicinal chemistry.
Formula:C7H13NO4
InChI:InChI=1S/C7H13NO4/c9-4-3-1-2-7(12,8-3)6(11)5(4)10/h3-6,8-12H,1-2H2/t3-,4+,5-,6+,7-/m1/s1
InChI key:InChIKey=FXFBVZOJVHCEDO-IBISWUOJSA-N
SMILES:O[C@]12N[C@](CC1)([C@H](O)[C@@H](O)[C@@H]2O)[H]
Synonyms:- (+)-Calystegin B<sub>2</sub>
- (+)-Calystegine B<sub>2</sub>
- (1R,2S,3R,4S,5R)-8-azabicyclo[3.2.1]octane-1,2,3,4-tetrol
- (1S,2R,3S,4R,5S)-8-azabicyclo[3.2.1]octane-1,2,3,4-tetrol
- (2-endo,3-exo,4-endo)-8-Azabicyclo(3.2.1)octane-1,2,3,4-tetrol
- (2S,3R,4S)-8-azabicyclo[3.2.1]octane-1,2,3,4-tetrol
- 1,2,3,4-Tetrahydroxy-nor-tropane
- 2-Epicalystegine B<sub>3</sub>
- 8-Azabicyclo(3.2.1)octane-1,2,3,4-tetrol, (2-endo,3-exo,4-endo)-
- 8-Azabicyclo[3.2.1]octane-1,2,3,4-tetrol, (1R,2S,3R,4S,5R)-
- 8-Azabicyclo[3.2.1]octane-1,2,3,4-tetrol, [1R-(2-endo,3-exo,4-endo)]-
- Calystegine B(3)
- Calystegine B(4)
- Calystegine B2
- Nortropanoline
- Calystegine B(2)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Calystegine B2
CAS:<p>Calystegines, including Calystegine B2, are alkaloids found in plants from the Solanaceae family, such as potatoes and aubergines. They are characterized by their polyhydroxylated nortropane ring system. Calystegines have the ability to inhibit glycosidases and interfere with carbohydrate metabolism, potentially leading to lysosomal storage toxicity. However, further research is needed to understand the specific effects of Calystegine B2 on humans. It is worth noting that, despite sharing a similar ring system, Calystegine B2 does not exhibit the same biological activity as tropane alkaloids.</p>Formula:C7H13NO4Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:175.19 g/mol

